C23H29NO4 — CID 55968507
3-(4-methoxyphenyl)-N-[(2-methoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)propanamide (PubChem CID 55968507) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N-[(2-methoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)propanamide.
| Compound Name | 3-(4-methoxyphenyl)-N-[(2-methoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 55968507 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 3-(4-methoxyphenyl)-N-[(2-methoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)propanamide |
| SMILES | COc1ccc(CCC(=O)N(Cc2ccccc2OC)CC2CCCO2)cc1 |
| InChI | InChI=1S/C23H29NO4/c1-26-20-12-9-18(10-13-20)11-14-23(25)24(17-21-7-5-15-28-21)16-19-6-3-4-8-22(19)27-2/h3-4,6,8-10,12-13,21H,5,7,11,14-17H2,1-2H3 |
| InChIKey | NJORKKXZNMXWPW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |