C22H26ClNO4 — CID 55968778
3-(3-chlorophenoxy)-N-[(2-methoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)propanamide (PubChem CID 55968778) has the molecular formula C22H26ClNO4 and a molecular weight of 403.91 g/mol. Its IUPAC name is 3-(3-chlorophenoxy)-N-[(2-methoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)propanamide.
| Compound Name | 3-(3-chlorophenoxy)-N-[(2-methoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 55968778 |
| Molecular Formula | C22H26ClNO4 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 3-(3-chlorophenoxy)-N-[(2-methoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)propanamide |
| SMILES | COc1ccccc1CN(CC1CCCO1)C(=O)CCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H26ClNO4/c1-26-21-10-3-2-6-17(21)15-24(16-20-9-5-12-27-20)22(25)11-13-28-19-8-4-7-18(23)14-19/h2-4,6-8,10,14,20H,5,9,11-13,15-16H2,1H3 |
| InChIKey | GFMPRDBQNVWRGP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |