C19H22F2N2O3S — CID 87003192
3-[[2-(difluoromethoxy)phenyl]methyl]-1-(oxolan-2-ylmethyl)-1-(thiophen-2-ylmethyl)urea (PubChem CID 87003192) has the molecular formula C19H22F2N2O3S and a molecular weight of 396.46 g/mol. Its IUPAC name is 3-[[2-(difluoromethoxy)phenyl]methyl]-1-(oxolan-2-ylmethyl)-1-(thiophen-2-ylmethyl)urea.
| Compound Name | 3-[[2-(difluoromethoxy)phenyl]methyl]-1-(oxolan-2-ylmethyl)-1-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 87003192 |
| Molecular Formula | C19H22F2N2O3S |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 3-[[2-(difluoromethoxy)phenyl]methyl]-1-(oxolan-2-ylmethyl)-1-(thiophen-2-ylmethyl)urea |
| SMILES | O=C(NCc1ccccc1OC(F)F)N(Cc1cccs1)CC1CCCO1 |
| InChI | InChI=1S/C19H22F2N2O3S/c20-18(21)26-17-8-2-1-5-14(17)11-22-19(24)23(12-15-6-3-9-25-15)13-16-7-4-10-27-16/h1-2,4-5,7-8,10,15,18H,3,6,9,11-13H2,(H,22,24) |
| InChIKey | KINMOFOAGMGEGO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |