C15H16FNO2S — CID 47044022
N-(3-fluoro-4-methoxyphenyl)-4-thiophen-2-ylbutanamide (PubChem CID 47044022) has the molecular formula C15H16FNO2S and a molecular weight of 293.36 g/mol. Its IUPAC name is N-(3-fluoro-4-methoxyphenyl)-4-thiophen-2-ylbutanamide.
| Compound Name | N-(3-fluoro-4-methoxyphenyl)-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 47044022 |
| Molecular Formula | C15H16FNO2S |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | N-(3-fluoro-4-methoxyphenyl)-4-thiophen-2-ylbutanamide |
| SMILES | COc1ccc(NC(=O)CCCc2cccs2)cc1F |
| InChI | InChI=1S/C15H16FNO2S/c1-19-14-8-7-11(10-13(14)16)17-15(18)6-2-4-12-5-3-9-20-12/h3,5,7-10H,2,4,6H2,1H3,(H,17,18) |
| InChIKey | POSQUCWYHPWPIM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |