C14H14INOS — CID 7688853
N-(3-iodophenyl)-4-thiophen-2-ylbutanamide (PubChem CID 7688853) has the molecular formula C14H14INOS and a molecular weight of 371.24 g/mol. Its IUPAC name is N-(3-iodophenyl)-4-thiophen-2-ylbutanamide.
| Compound Name | N-(3-iodophenyl)-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 7688853 |
| Molecular Formula | C14H14INOS |
| Molecular Weight | 371.24 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | N-(3-iodophenyl)-4-thiophen-2-ylbutanamide |
| SMILES | O=C(CCCc1cccs1)Nc1cccc(I)c1 |
| InChI | InChI=1S/C14H14INOS/c15-11-4-1-5-12(10-11)16-14(17)8-2-6-13-7-3-9-18-13/h1,3-5,7,9-10H,2,6,8H2,(H,16,17) |
| InChIKey | PXWUPTZAKVPFFD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.24 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|