C13H13IN2OS — CID 3732089
1-(3-iodophenyl)-3-(2-thiophen-2-ylethyl)urea (PubChem CID 3732089) has the molecular formula C13H13IN2OS and a molecular weight of 372.23 g/mol. Its IUPAC name is 1-(3-iodophenyl)-3-(2-thiophen-2-ylethyl)urea.
| Compound Name | 1-(3-iodophenyl)-3-(2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 3732089 |
| Molecular Formula | C13H13IN2OS |
| Molecular Weight | 372.23 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | 1-(3-iodophenyl)-3-(2-thiophen-2-ylethyl)urea |
| SMILES | O=C(NCCc1cccs1)Nc1cccc(I)c1 |
| InChI | InChI=1S/C13H13IN2OS/c14-10-3-1-4-11(9-10)16-13(17)15-7-6-12-5-2-8-18-12/h1-5,8-9H,6-7H2,(H2,15,16,17) |
| InChIKey | RABRVPQNPJNHBD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.23 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|