C13H12IN3O3S — CID 66373706
2-[2-[(3-iodophenyl)carbamoylamino]ethyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 66373706) has the molecular formula C13H12IN3O3S and a molecular weight of 417.23 g/mol. Its IUPAC name is 2-[2-[(3-iodophenyl)carbamoylamino]ethyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-[(3-iodophenyl)carbamoylamino]ethyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66373706 |
| Molecular Formula | C13H12IN3O3S |
| Molecular Weight | 417.23 g/mol |
| Exact Mass | 416.96 |
| IUPAC Name | 2-[2-[(3-iodophenyl)carbamoylamino]ethyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(NCCc1nc(C(=O)O)cs1)Nc1cccc(I)c1 |
| InChI | InChI=1S/C13H12IN3O3S/c14-8-2-1-3-9(6-8)16-13(20)15-5-4-11-17-10(7-21-11)12(18)19/h1-3,6-7H,4-5H2,(H,18,19)(H2,15,16,20) |
| InChIKey | CNODXQXOYMUZCT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.23 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|