C15H18ClN3OS — CID 110446875
1-(3-chlorophenyl)-3-[2-(4-propan-2-yl-1,3-thiazol-2-yl)ethyl]urea (PubChem CID 110446875) has the molecular formula C15H18ClN3OS and a molecular weight of 323.85 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[2-(4-propan-2-yl-1,3-thiazol-2-yl)ethyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[2-(4-propan-2-yl-1,3-thiazol-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 110446875 |
| Molecular Formula | C15H18ClN3OS |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[2-(4-propan-2-yl-1,3-thiazol-2-yl)ethyl]urea |
| SMILES | CC(C)c1csc(CCNC(=O)Nc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C15H18ClN3OS/c1-10(2)13-9-21-14(19-13)6-7-17-15(20)18-12-5-3-4-11(16)8-12/h3-5,8-10H,6-7H2,1-2H3,(H2,17,18,20) |
| InChIKey | UHRTVLINMRIHDT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |