C17H15ClN4OS — CID 110317792
1-(3-chlorophenyl)-3-[2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]urea (PubChem CID 110317792) has the molecular formula C17H15ClN4OS and a molecular weight of 358.85 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 110317792 |
| Molecular Formula | C17H15ClN4OS |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]urea |
| SMILES | O=C(NCCc1nc(-c2ccncc2)cs1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H15ClN4OS/c18-13-2-1-3-14(10-13)21-17(23)20-9-6-16-22-15(11-24-16)12-4-7-19-8-5-12/h1-5,7-8,10-11H,6,9H2,(H2,20,21,23) |
| InChIKey | UPMMLRCELKNNBB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |