C19H19ClN4OS — CID 56549783
1-(3-chloro-4-methylphenyl)-3-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]urea (PubChem CID 56549783) has the molecular formula C19H19ClN4OS and a molecular weight of 386.91 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]urea |
|---|---|
| PubChem CID | 56549783 |
| Molecular Formula | C19H19ClN4OS |
| Molecular Weight | 386.91 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]urea |
| SMILES | Cc1ccc(NC(=O)NCCCc2nc(-c3ccncc3)cs2)cc1Cl |
| InChI | InChI=1S/C19H19ClN4OS/c1-13-4-5-15(11-16(13)20)23-19(25)22-8-2-3-18-24-17(12-26-18)14-6-9-21-10-7-14/h4-7,9-12H,2-3,8H2,1H3,(H2,22,23,25) |
| InChIKey | ZCWNEHUEUDOQOZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.91 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|