C14H19ClN4OS — CID 120704270
2-(methylamino)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]acetamide;hydrochloride (PubChem CID 120704270) has the molecular formula C14H19ClN4OS and a molecular weight of 326.85 g/mol. Its IUPAC name is 2-(methylamino)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]acetamide;hydrochloride.
| Compound Name | 2-(methylamino)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 120704270 |
| Molecular Formula | C14H19ClN4OS |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 2-(methylamino)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]acetamide;hydrochloride |
| SMILES | CNCC(=O)NCCCc1nc(-c2ccncc2)cs1.Cl |
| InChI | InChI=1S/C14H18N4OS.ClH/c1-15-9-13(19)17-6-2-3-14-18-12(10-20-14)11-4-7-16-8-5-11;/h4-5,7-8,10,15H,2-3,6,9H2,1H3,(H,17,19);1H |
| InChIKey | DMVCTIJRNFDIJF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|