C20H22N4OS — CID 120596443
2-amino-2-phenyl-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]propanamide (PubChem CID 120596443) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is 2-amino-2-phenyl-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]propanamide.
| Compound Name | 2-amino-2-phenyl-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]propanamide |
|---|---|
| PubChem CID | 120596443 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-amino-2-phenyl-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]propanamide |
| SMILES | CC(N)(C(=O)NCCCc1nc(-c2ccncc2)cs1)c1ccccc1 |
| InChI | InChI=1S/C20H22N4OS/c1-20(21,16-6-3-2-4-7-16)19(25)23-11-5-8-18-24-17(14-26-18)15-9-12-22-13-10-15/h2-4,6-7,9-10,12-14H,5,8,11,21H2,1H3,(H,23,25) |
| InChIKey | IWFBAVWZIIOYNX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|