C21H24N6O2S — CID 56550022
1-(6-morpholin-4-yl-3-pyridinyl)-3-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]urea (PubChem CID 56550022) has the molecular formula C21H24N6O2S and a molecular weight of 424.53 g/mol. Its IUPAC name is 1-(6-morpholin-4-yl-3-pyridinyl)-3-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]urea.
| Compound Name | 1-(6-morpholin-4-yl-3-pyridinyl)-3-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]urea |
|---|---|
| PubChem CID | 56550022 |
| Molecular Formula | C21H24N6O2S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 1-(6-morpholin-4-yl-3-pyridinyl)-3-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]urea |
| SMILES | O=C(NCCCc1nc(-c2ccncc2)cs1)Nc1ccc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C21H24N6O2S/c28-21(25-17-3-4-19(24-14-17)27-10-12-29-13-11-27)23-7-1-2-20-26-18(15-30-20)16-5-8-22-9-6-16/h3-6,8-9,14-15H,1-2,7,10-13H2,(H2,23,25,28) |
| InChIKey | RHLUGXHPBDZHFH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|