C12H10IN3O3S — CID 66379765
2-[[(3-iodophenyl)carbamoylamino]methyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 66379765) has the molecular formula C12H10IN3O3S and a molecular weight of 403.20 g/mol. Its IUPAC name is 2-[[(3-iodophenyl)carbamoylamino]methyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[[(3-iodophenyl)carbamoylamino]methyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66379765 |
| Molecular Formula | C12H10IN3O3S |
| Molecular Weight | 403.20 g/mol |
| Exact Mass | 402.95 |
| IUPAC Name | 2-[[(3-iodophenyl)carbamoylamino]methyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(NCc1nc(C(=O)O)cs1)Nc1cccc(I)c1 |
| InChI | InChI=1S/C12H10IN3O3S/c13-7-2-1-3-8(4-7)15-12(19)14-5-10-16-9(6-20-10)11(17)18/h1-4,6H,5H2,(H,17,18)(H2,14,15,19) |
| InChIKey | VKCPBNOANLUGHH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.20 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|