C12H14N4OS — CID 54962764
1-(3-aminophenyl)-3-[(4-methyl-1,3-thiazol-2-yl)methyl]urea (PubChem CID 54962764) has the molecular formula C12H14N4OS and a molecular weight of 262.34 g/mol. Its IUPAC name is 1-(3-aminophenyl)-3-[(4-methyl-1,3-thiazol-2-yl)methyl]urea.
| Compound Name | 1-(3-aminophenyl)-3-[(4-methyl-1,3-thiazol-2-yl)methyl]urea |
|---|---|
| PubChem CID | 54962764 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 1-(3-aminophenyl)-3-[(4-methyl-1,3-thiazol-2-yl)methyl]urea |
| SMILES | Cc1csc(CNC(=O)Nc2cccc(N)c2)n1 |
| InChI | InChI=1S/C12H14N4OS/c1-8-7-18-11(15-8)6-14-12(17)16-10-4-2-3-9(13)5-10/h2-5,7H,6,13H2,1H3,(H2,14,16,17) |
| InChIKey | GTUMCCHVISBUDU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|