C14H16N4O — CID 114956458
1-(3-aminophenyl)-3-[(4-methyl-3-pyridinyl)methyl]urea (PubChem CID 114956458) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 1-(3-aminophenyl)-3-[(4-methyl-3-pyridinyl)methyl]urea.
| Compound Name | 1-(3-aminophenyl)-3-[(4-methyl-3-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 114956458 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 1-(3-aminophenyl)-3-[(4-methyl-3-pyridinyl)methyl]urea |
| SMILES | Cc1ccncc1CNC(=O)Nc1cccc(N)c1 |
| InChI | InChI=1S/C14H16N4O/c1-10-5-6-16-8-11(10)9-17-14(19)18-13-4-2-3-12(15)7-13/h2-8H,9,15H2,1H3,(H2,17,18,19) |
| InChIKey | LTYNKKLVXVKYEL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|