C18H24N4O3S2 — CID 55696462
1-[3-(azepan-1-ylsulfonyl)phenyl]-3-[(4-methyl-1,3-thiazol-2-yl)methyl]urea (PubChem CID 55696462) has the molecular formula C18H24N4O3S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 1-[3-(azepan-1-ylsulfonyl)phenyl]-3-[(4-methyl-1,3-thiazol-2-yl)methyl]urea.
| Compound Name | 1-[3-(azepan-1-ylsulfonyl)phenyl]-3-[(4-methyl-1,3-thiazol-2-yl)methyl]urea |
|---|---|
| PubChem CID | 55696462 |
| Molecular Formula | C18H24N4O3S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 1-[3-(azepan-1-ylsulfonyl)phenyl]-3-[(4-methyl-1,3-thiazol-2-yl)methyl]urea |
| SMILES | Cc1csc(CNC(=O)Nc2cccc(S(=O)(=O)N3CCCCCC3)c2)n1 |
| InChI | InChI=1S/C18H24N4O3S2/c1-14-13-26-17(20-14)12-19-18(23)21-15-7-6-8-16(11-15)27(24,25)22-9-4-2-3-5-10-22/h6-8,11,13H,2-5,9-10,12H2,1H3,(H2,19,21,23) |
| InChIKey | IMSCTLXSMLKKBO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |