C17H20ClN3OS2 — CID 60612095
1-(3-chloro-4-thiomorpholin-4-ylphenyl)-3-(2-thiophen-2-ylethyl)urea (PubChem CID 60612095) has the molecular formula C17H20ClN3OS2 and a molecular weight of 381.95 g/mol. Its IUPAC name is 1-(3-chloro-4-thiomorpholin-4-ylphenyl)-3-(2-thiophen-2-ylethyl)urea.
| Compound Name | 1-(3-chloro-4-thiomorpholin-4-ylphenyl)-3-(2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 60612095 |
| Molecular Formula | C17H20ClN3OS2 |
| Molecular Weight | 381.95 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 1-(3-chloro-4-thiomorpholin-4-ylphenyl)-3-(2-thiophen-2-ylethyl)urea |
| SMILES | O=C(NCCc1cccs1)Nc1ccc(N2CCSCC2)c(Cl)c1 |
| InChI | InChI=1S/C17H20ClN3OS2/c18-15-12-13(3-4-16(15)21-7-10-23-11-8-21)20-17(22)19-6-5-14-2-1-9-24-14/h1-4,9,12H,5-8,10-11H2,(H2,19,20,22) |
| InChIKey | FRVKXNWZQSSACQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.95 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|