C15H20ClN3O2S — CID 91641959
N-(3-chloro-4-thiomorpholin-4-ylphenyl)-N'-propan-2-yloxamide (PubChem CID 91641959) has the molecular formula C15H20ClN3O2S and a molecular weight of 341.86 g/mol. Its IUPAC name is N-(3-chloro-4-thiomorpholin-4-ylphenyl)-N'-propan-2-yloxamide.
| Compound Name | N-(3-chloro-4-thiomorpholin-4-ylphenyl)-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 91641959 |
| Molecular Formula | C15H20ClN3O2S |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-(3-chloro-4-thiomorpholin-4-ylphenyl)-N'-propan-2-yloxamide |
| SMILES | CC(C)NC(=O)C(=O)Nc1ccc(N2CCSCC2)c(Cl)c1 |
| InChI | InChI=1S/C15H20ClN3O2S/c1-10(2)17-14(20)15(21)18-11-3-4-13(12(16)9-11)19-5-7-22-8-6-19/h3-4,9-10H,5-8H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | RBZAFZRWHURAJE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|