C21H19ClN4OS — CID 51129835
N-(3-chloro-4-thiomorpholin-4-ylphenyl)-2-phenylpyrimidine-5-carboxamide (PubChem CID 51129835) has the molecular formula C21H19ClN4OS and a molecular weight of 410.93 g/mol. Its IUPAC name is N-(3-chloro-4-thiomorpholin-4-ylphenyl)-2-phenylpyrimidine-5-carboxamide.
| Compound Name | N-(3-chloro-4-thiomorpholin-4-ylphenyl)-2-phenylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 51129835 |
| Molecular Formula | C21H19ClN4OS |
| Molecular Weight | 410.93 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | N-(3-chloro-4-thiomorpholin-4-ylphenyl)-2-phenylpyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCSCC2)c(Cl)c1)c1cnc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C21H19ClN4OS/c22-18-12-17(6-7-19(18)26-8-10-28-11-9-26)25-21(27)16-13-23-20(24-14-16)15-4-2-1-3-5-15/h1-7,12-14H,8-11H2,(H,25,27) |
| InChIKey | GMPRWHBAGBVJJW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.93 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|