C18H17ClF2N2OS — CID 144890778
N-(3-chloro-4-fluorophenyl)-4-fluoro-3-(1,4-thiazepan-4-yl)benzamide (PubChem CID 144890778) has the molecular formula C18H17ClF2N2OS and a molecular weight of 382.86 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-4-fluoro-3-(1,4-thiazepan-4-yl)benzamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-4-fluoro-3-(1,4-thiazepan-4-yl)benzamide |
|---|---|
| PubChem CID | 144890778 |
| Molecular Formula | C18H17ClF2N2OS |
| Molecular Weight | 382.86 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-4-fluoro-3-(1,4-thiazepan-4-yl)benzamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)c1ccc(F)c(N2CCCSCC2)c1 |
| InChI | InChI=1S/C18H17ClF2N2OS/c19-14-11-13(3-5-15(14)20)22-18(24)12-2-4-16(21)17(10-12)23-6-1-8-25-9-7-23/h2-5,10-11H,1,6-9H2,(H,22,24) |
| InChIKey | CODJMUURECSNJN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.86 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |