C18H24ClN3O3 — CID 97342486
N-[(2S,3S)-1-(3-chloro-4-pyrrolidin-1-ylanilino)-3-hydroxy-1-oxobutan-2-yl]cyclopropanecarboxamide (PubChem CID 97342486) has the molecular formula C18H24ClN3O3 and a molecular weight of 365.86 g/mol. Its IUPAC name is N-[(2S,3S)-1-(3-chloro-4-pyrrolidin-1-ylanilino)-3-hydroxy-1-oxobutan-2-yl]cyclopropanecarboxamide.
| Compound Name | N-[(2S,3S)-1-(3-chloro-4-pyrrolidin-1-ylanilino)-3-hydroxy-1-oxobutan-2-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 97342486 |
| Molecular Formula | C18H24ClN3O3 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | N-[(2S,3S)-1-(3-chloro-4-pyrrolidin-1-ylanilino)-3-hydroxy-1-oxobutan-2-yl]cyclopropanecarboxamide |
| SMILES | C[C@H](O)[C@H](NC(=O)C1CC1)C(=O)Nc1ccc(N2CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C18H24ClN3O3/c1-11(23)16(21-17(24)12-4-5-12)18(25)20-13-6-7-15(14(19)10-13)22-8-2-3-9-22/h6-7,10-12,16,23H,2-5,8-9H2,1H3,(H,20,25)(H,21,24)/t11-,16-/m0/s1 |
| InChIKey | QKVATGBDQSMIJS-ZBEGNZNMSA-N |
| XLogP | 2.15 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|