C19H27ClN2O3 — CID 48861457
N-(3-chloro-4-piperidin-1-ylphenyl)-2-(oxolan-2-ylmethoxy)propanamide (PubChem CID 48861457) has the molecular formula C19H27ClN2O3 and a molecular weight of 366.89 g/mol. Its IUPAC name is N-(3-chloro-4-piperidin-1-ylphenyl)-2-(oxolan-2-ylmethoxy)propanamide.
| Compound Name | N-(3-chloro-4-piperidin-1-ylphenyl)-2-(oxolan-2-ylmethoxy)propanamide |
|---|---|
| PubChem CID | 48861457 |
| Molecular Formula | C19H27ClN2O3 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-(3-chloro-4-piperidin-1-ylphenyl)-2-(oxolan-2-ylmethoxy)propanamide |
| SMILES | CC(OCC1CCCO1)C(=O)Nc1ccc(N2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C19H27ClN2O3/c1-14(25-13-16-6-5-11-24-16)19(23)21-15-7-8-18(17(20)12-15)22-9-3-2-4-10-22/h7-8,12,14,16H,2-6,9-11,13H2,1H3,(H,21,23) |
| InChIKey | SKLOSNSBVYLDAF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|