C16H21NO4 — CID 48845435
N-(4-acetylphenyl)-2-(oxolan-2-ylmethoxy)propanamide (PubChem CID 48845435) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-(oxolan-2-ylmethoxy)propanamide.
| Compound Name | N-(4-acetylphenyl)-2-(oxolan-2-ylmethoxy)propanamide |
|---|---|
| PubChem CID | 48845435 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | N-(4-acetylphenyl)-2-(oxolan-2-ylmethoxy)propanamide |
| SMILES | CC(=O)c1ccc(NC(=O)C(C)OCC2CCCO2)cc1 |
| InChI | InChI=1S/C16H21NO4/c1-11(18)13-5-7-14(8-6-13)17-16(19)12(2)21-10-15-4-3-9-20-15/h5-8,12,15H,3-4,9-10H2,1-2H3,(H,17,19) |
| InChIKey | NDKFEJAUMXNIEJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |