C19H26N2O4 — CID 75440615
N-[1-(2-methoxyethyl)indol-6-yl]-2-(oxolan-2-ylmethoxy)propanamide (PubChem CID 75440615) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-[1-(2-methoxyethyl)indol-6-yl]-2-(oxolan-2-ylmethoxy)propanamide.
| Compound Name | N-[1-(2-methoxyethyl)indol-6-yl]-2-(oxolan-2-ylmethoxy)propanamide |
|---|---|
| PubChem CID | 75440615 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | N-[1-(2-methoxyethyl)indol-6-yl]-2-(oxolan-2-ylmethoxy)propanamide |
| SMILES | COCCn1ccc2ccc(NC(=O)C(C)OCC3CCCO3)cc21 |
| InChI | InChI=1S/C19H26N2O4/c1-14(25-13-17-4-3-10-24-17)19(22)20-16-6-5-15-7-8-21(9-11-23-2)18(15)12-16/h5-8,12,14,17H,3-4,9-11,13H2,1-2H3,(H,20,22) |
| InChIKey | YLQNUPDLJAMRLV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |