C16H19N3O5 — CID 126834368
5-[2-(oxolan-2-ylmethoxy)propanoylamino]-1,3-benzoxazole-2-carboxamide (PubChem CID 126834368) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is 5-[2-(oxolan-2-ylmethoxy)propanoylamino]-1,3-benzoxazole-2-carboxamide.
| Compound Name | 5-[2-(oxolan-2-ylmethoxy)propanoylamino]-1,3-benzoxazole-2-carboxamide |
|---|---|
| PubChem CID | 126834368 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 5-[2-(oxolan-2-ylmethoxy)propanoylamino]-1,3-benzoxazole-2-carboxamide |
| SMILES | CC(OCC1CCCO1)C(=O)Nc1ccc2oc(C(N)=O)nc2c1 |
| InChI | InChI=1S/C16H19N3O5/c1-9(23-8-11-3-2-6-22-11)15(21)18-10-4-5-13-12(7-10)19-16(24-13)14(17)20/h4-5,7,9,11H,2-3,6,8H2,1H3,(H2,17,20)(H,18,21) |
| InChIKey | HRCVXWXEDHVVFJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |