C15H19NO5 — CID 97233672
4-[[(2R)-2-[[(2R)-oxolan-2-yl]methoxy]propanoyl]amino]benzoic acid (PubChem CID 97233672) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is 4-[[(2R)-2-[[(2R)-oxolan-2-yl]methoxy]propanoyl]amino]benzoic acid.
| Compound Name | 4-[[(2R)-2-[[(2R)-oxolan-2-yl]methoxy]propanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 97233672 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 4-[[(2R)-2-[[(2R)-oxolan-2-yl]methoxy]propanoyl]amino]benzoic acid |
| SMILES | C[C@@H](OC[C@H]1CCCO1)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C15H19NO5/c1-10(21-9-13-3-2-8-20-13)14(17)16-12-6-4-11(5-7-12)15(18)19/h4-7,10,13H,2-3,8-9H2,1H3,(H,16,17)(H,18,19)/t10-,13-/m1/s1 |
| InChIKey | FGXXSRSQGPPQAV-ZWNOBZJWSA-N |
| XLogP | 1.91 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |