C18H27NO4 — CID 51126483
N-(5-tert-butyl-2-hydroxyphenyl)-2-(oxolan-2-ylmethoxy)propanamide (PubChem CID 51126483) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is N-(5-tert-butyl-2-hydroxyphenyl)-2-(oxolan-2-ylmethoxy)propanamide.
| Compound Name | N-(5-tert-butyl-2-hydroxyphenyl)-2-(oxolan-2-ylmethoxy)propanamide |
|---|---|
| PubChem CID | 51126483 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | N-(5-tert-butyl-2-hydroxyphenyl)-2-(oxolan-2-ylmethoxy)propanamide |
| SMILES | CC(OCC1CCCO1)C(=O)Nc1cc(C(C)(C)C)ccc1O |
| InChI | InChI=1S/C18H27NO4/c1-12(23-11-14-6-5-9-22-14)17(21)19-15-10-13(18(2,3)4)7-8-16(15)20/h7-8,10,12,14,20H,5-6,9,11H2,1-4H3,(H,19,21) |
| InChIKey | QLPYLKXVUBIUNY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|