C15H17F4NO3 — CID 95286084
(2R)-N-[2-fluoro-5-(trifluoromethyl)phenyl]-2-[[(2S)-oxolan-2-yl]methoxy]propanamide (PubChem CID 95286084) has the molecular formula C15H17F4NO3 and a molecular weight of 335.30 g/mol. Its IUPAC name is (2R)-N-[2-fluoro-5-(trifluoromethyl)phenyl]-2-[[(2S)-oxolan-2-yl]methoxy]propanamide.
| Compound Name | (2R)-N-[2-fluoro-5-(trifluoromethyl)phenyl]-2-[[(2S)-oxolan-2-yl]methoxy]propanamide |
|---|---|
| PubChem CID | 95286084 |
| Molecular Formula | C15H17F4NO3 |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | (2R)-N-[2-fluoro-5-(trifluoromethyl)phenyl]-2-[[(2S)-oxolan-2-yl]methoxy]propanamide |
| SMILES | C[C@@H](OC[C@@H]1CCCO1)C(=O)Nc1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C15H17F4NO3/c1-9(23-8-11-3-2-6-22-11)14(21)20-13-7-10(15(17,18)19)4-5-12(13)16/h4-5,7,9,11H,2-3,6,8H2,1H3,(H,20,21)/t9-,11+/m1/s1 |
| InChIKey | BNPUMSIVHWTNSJ-KOLCDFICSA-N |
| XLogP | 3.37 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |