C15H19FN2O4 — CID 47080643
4-fluoro-N'-[2-(oxolan-2-ylmethoxy)propanoyl]benzohydrazide (PubChem CID 47080643) has the molecular formula C15H19FN2O4 and a molecular weight of 310.32 g/mol. Its IUPAC name is 4-fluoro-N'-[2-(oxolan-2-ylmethoxy)propanoyl]benzohydrazide.
| Compound Name | 4-fluoro-N'-[2-(oxolan-2-ylmethoxy)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 47080643 |
| Molecular Formula | C15H19FN2O4 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 4-fluoro-N'-[2-(oxolan-2-ylmethoxy)propanoyl]benzohydrazide |
| SMILES | CC(OCC1CCCO1)C(=O)NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H19FN2O4/c1-10(22-9-13-3-2-8-21-13)14(19)17-18-15(20)11-4-6-12(16)7-5-11/h4-7,10,13H,2-3,8-9H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | QAMPMQJGYGEIAD-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|