C18H24FNO3 — CID 98762105
(2S)-N-[(R)-cyclopropyl-(4-fluorophenyl)methyl]-2-[[(2R)-oxolan-2-yl]methoxy]propanamide (PubChem CID 98762105) has the molecular formula C18H24FNO3 and a molecular weight of 321.39 g/mol. Its IUPAC name is (2S)-N-[(R)-cyclopropyl-(4-fluorophenyl)methyl]-2-[[(2R)-oxolan-2-yl]methoxy]propanamide.
| Compound Name | (2S)-N-[(R)-cyclopropyl-(4-fluorophenyl)methyl]-2-[[(2R)-oxolan-2-yl]methoxy]propanamide |
|---|---|
| PubChem CID | 98762105 |
| Molecular Formula | C18H24FNO3 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (2S)-N-[(R)-cyclopropyl-(4-fluorophenyl)methyl]-2-[[(2R)-oxolan-2-yl]methoxy]propanamide |
| SMILES | C[C@H](OC[C@H]1CCCO1)C(=O)N[C@@H](c1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C18H24FNO3/c1-12(23-11-16-3-2-10-22-16)18(21)20-17(13-4-5-13)14-6-8-15(19)9-7-14/h6-9,12-13,16-17H,2-5,10-11H2,1H3,(H,20,21)/t12-,16+,17+/m0/s1 |
| InChIKey | KDGWFFSYEOGSPR-JCURWCKSSA-N |
| XLogP | 2.98 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |