C18H26FNO4 — CID 95154419
(2R)-N-[(2R)-1-(2-fluorophenoxy)propan-2-yl]-2-[[(2S)-oxan-2-yl]methoxy]propanamide (PubChem CID 95154419) has the molecular formula C18H26FNO4 and a molecular weight of 339.41 g/mol. Its IUPAC name is (2R)-N-[(2R)-1-(2-fluorophenoxy)propan-2-yl]-2-[[(2S)-oxan-2-yl]methoxy]propanamide.
| Compound Name | (2R)-N-[(2R)-1-(2-fluorophenoxy)propan-2-yl]-2-[[(2S)-oxan-2-yl]methoxy]propanamide |
|---|---|
| PubChem CID | 95154419 |
| Molecular Formula | C18H26FNO4 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (2R)-N-[(2R)-1-(2-fluorophenoxy)propan-2-yl]-2-[[(2S)-oxan-2-yl]methoxy]propanamide |
| SMILES | C[C@H](COc1ccccc1F)NC(=O)[C@@H](C)OC[C@@H]1CCCCO1 |
| InChI | InChI=1S/C18H26FNO4/c1-13(11-24-17-9-4-3-8-16(17)19)20-18(21)14(2)23-12-15-7-5-6-10-22-15/h3-4,8-9,13-15H,5-7,10-12H2,1-2H3,(H,20,21)/t13-,14-,15+/m1/s1 |
| InChIKey | JHJDKXCWYZQOFW-KFWWJZLASA-N |
| XLogP | 2.68 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |