C15H21NO5S — CID 95272601
(2R)-N-(benzenesulfonyl)-2-[[(2R)-oxan-2-yl]methoxy]propanamide (PubChem CID 95272601) has the molecular formula C15H21NO5S and a molecular weight of 327.40 g/mol. Its IUPAC name is (2R)-N-(benzenesulfonyl)-2-[[(2R)-oxan-2-yl]methoxy]propanamide.
| Compound Name | (2R)-N-(benzenesulfonyl)-2-[[(2R)-oxan-2-yl]methoxy]propanamide |
|---|---|
| PubChem CID | 95272601 |
| Molecular Formula | C15H21NO5S |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | (2R)-N-(benzenesulfonyl)-2-[[(2R)-oxan-2-yl]methoxy]propanamide |
| SMILES | C[C@@H](OC[C@H]1CCCCO1)C(=O)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H21NO5S/c1-12(21-11-13-7-5-6-10-20-13)15(17)16-22(18,19)14-8-3-2-4-9-14/h2-4,8-9,12-13H,5-7,10-11H2,1H3,(H,16,17)/t12-,13-/m1/s1 |
| InChIKey | XBSISYFNGMQLDL-CHWSQXEVSA-N |
| XLogP | 1.47 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |