C14H18ClNO5S — CID 71884570
N-(3-chlorophenyl)sulfonyl-2-(oxolan-2-ylmethoxy)propanamide (PubChem CID 71884570) has the molecular formula C14H18ClNO5S and a molecular weight of 347.82 g/mol. Its IUPAC name is N-(3-chlorophenyl)sulfonyl-2-(oxolan-2-ylmethoxy)propanamide.
| Compound Name | N-(3-chlorophenyl)sulfonyl-2-(oxolan-2-ylmethoxy)propanamide |
|---|---|
| PubChem CID | 71884570 |
| Molecular Formula | C14H18ClNO5S |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | N-(3-chlorophenyl)sulfonyl-2-(oxolan-2-ylmethoxy)propanamide |
| SMILES | CC(OCC1CCCO1)C(=O)NS(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H18ClNO5S/c1-10(21-9-12-5-3-7-20-12)14(17)16-22(18,19)13-6-2-4-11(15)8-13/h2,4,6,8,10,12H,3,5,7,9H2,1H3,(H,16,17) |
| InChIKey | CPUWALFULUAOEE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |