C15H18N2O5S — CID 95270061
(2R)-N-(3-cyanophenyl)sulfonyl-2-[[(2R)-oxolan-2-yl]methoxy]propanamide (PubChem CID 95270061) has the molecular formula C15H18N2O5S and a molecular weight of 338.38 g/mol. Its IUPAC name is (2R)-N-(3-cyanophenyl)sulfonyl-2-[[(2R)-oxolan-2-yl]methoxy]propanamide.
| Compound Name | (2R)-N-(3-cyanophenyl)sulfonyl-2-[[(2R)-oxolan-2-yl]methoxy]propanamide |
|---|---|
| PubChem CID | 95270061 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (2R)-N-(3-cyanophenyl)sulfonyl-2-[[(2R)-oxolan-2-yl]methoxy]propanamide |
| SMILES | C[C@@H](OC[C@H]1CCCO1)C(=O)NS(=O)(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C15H18N2O5S/c1-11(22-10-13-5-3-7-21-13)15(18)17-23(19,20)14-6-2-4-12(8-14)9-16/h2,4,6,8,11,13H,3,5,7,10H2,1H3,(H,17,18)/t11-,13-/m1/s1 |
| InChIKey | XQVRAGMYVXDWDB-DGCLKSJQSA-N |
| XLogP | 0.95 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |