C13H19NO5S2 — CID 95272613
(2R)-2-[[(2R)-oxan-2-yl]methoxy]-N-thiophen-2-ylsulfonylpropanamide (PubChem CID 95272613) has the molecular formula C13H19NO5S2 and a molecular weight of 333.43 g/mol. Its IUPAC name is (2R)-2-[[(2R)-oxan-2-yl]methoxy]-N-thiophen-2-ylsulfonylpropanamide.
| Compound Name | (2R)-2-[[(2R)-oxan-2-yl]methoxy]-N-thiophen-2-ylsulfonylpropanamide |
|---|---|
| PubChem CID | 95272613 |
| Molecular Formula | C13H19NO5S2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | (2R)-2-[[(2R)-oxan-2-yl]methoxy]-N-thiophen-2-ylsulfonylpropanamide |
| SMILES | C[C@@H](OC[C@H]1CCCCO1)C(=O)NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C13H19NO5S2/c1-10(19-9-11-5-2-3-7-18-11)13(15)14-21(16,17)12-6-4-8-20-12/h4,6,8,10-11H,2-3,5,7,9H2,1H3,(H,14,15)/t10-,11-/m1/s1 |
| InChIKey | UWJVMJCSTVLLNR-GHMZBOCLSA-N |
| XLogP | 1.53 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |