C16H21F2NO4 — CID 95281098
(2S)-N-[2-(difluoromethoxy)-6-methylphenyl]-2-[[(2S)-oxolan-2-yl]methoxy]propanamide (PubChem CID 95281098) has the molecular formula C16H21F2NO4 and a molecular weight of 329.34 g/mol. Its IUPAC name is (2S)-N-[2-(difluoromethoxy)-6-methylphenyl]-2-[[(2S)-oxolan-2-yl]methoxy]propanamide.
| Compound Name | (2S)-N-[2-(difluoromethoxy)-6-methylphenyl]-2-[[(2S)-oxolan-2-yl]methoxy]propanamide |
|---|---|
| PubChem CID | 95281098 |
| Molecular Formula | C16H21F2NO4 |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | (2S)-N-[2-(difluoromethoxy)-6-methylphenyl]-2-[[(2S)-oxolan-2-yl]methoxy]propanamide |
| SMILES | Cc1cccc(OC(F)F)c1NC(=O)[C@H](C)OC[C@@H]1CCCO1 |
| InChI | InChI=1S/C16H21F2NO4/c1-10-5-3-7-13(23-16(17)18)14(10)19-15(20)11(2)22-9-12-6-4-8-21-12/h3,5,7,11-12,16H,4,6,8-9H2,1-2H3,(H,19,20)/t11-,12-/m0/s1 |
| InChIKey | XUPRFPQGJFAYNM-RYUDHWBXSA-N |
| XLogP | 3.12 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |