C17H24N2O3S — CID 124515209
(2S)-N-(5-tert-butyl-2-cyanothiophen-3-yl)-2-[[(2R)-oxolan-2-yl]methoxy]propanamide (PubChem CID 124515209) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is (2S)-N-(5-tert-butyl-2-cyanothiophen-3-yl)-2-[[(2R)-oxolan-2-yl]methoxy]propanamide.
| Compound Name | (2S)-N-(5-tert-butyl-2-cyanothiophen-3-yl)-2-[[(2R)-oxolan-2-yl]methoxy]propanamide |
|---|---|
| PubChem CID | 124515209 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (2S)-N-(5-tert-butyl-2-cyanothiophen-3-yl)-2-[[(2R)-oxolan-2-yl]methoxy]propanamide |
| SMILES | C[C@H](OC[C@H]1CCCO1)C(=O)Nc1cc(C(C)(C)C)sc1C#N |
| InChI | InChI=1S/C17H24N2O3S/c1-11(22-10-12-6-5-7-21-12)16(20)19-13-8-15(17(2,3)4)23-14(13)9-18/h8,11-12H,5-7,10H2,1-4H3,(H,19,20)/t11-,12+/m0/s1 |
| InChIKey | LOTYZYZYANVTOS-NWDGAFQWSA-N |
| XLogP | 3.44 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |