C22H27ClN2O3 — CID 49263668
N-[3-chloro-4-(1-phenylethylamino)phenyl]-2-(oxolan-2-ylmethoxy)propanamide (PubChem CID 49263668) has the molecular formula C22H27ClN2O3 and a molecular weight of 402.92 g/mol. Its IUPAC name is N-[3-chloro-4-(1-phenylethylamino)phenyl]-2-(oxolan-2-ylmethoxy)propanamide.
| Compound Name | N-[3-chloro-4-(1-phenylethylamino)phenyl]-2-(oxolan-2-ylmethoxy)propanamide |
|---|---|
| PubChem CID | 49263668 |
| Molecular Formula | C22H27ClN2O3 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-[3-chloro-4-(1-phenylethylamino)phenyl]-2-(oxolan-2-ylmethoxy)propanamide |
| SMILES | CC(OCC1CCCO1)C(=O)Nc1ccc(NC(C)c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C22H27ClN2O3/c1-15(17-7-4-3-5-8-17)24-21-11-10-18(13-20(21)23)25-22(26)16(2)28-14-19-9-6-12-27-19/h3-5,7-8,10-11,13,15-16,19,24H,6,9,12,14H2,1-2H3,(H,25,26) |
| InChIKey | JKUBRAKQCTVSIU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |