C14H18N4O3 — CID 126832682
N-imidazo[1,2-a]pyrimidin-6-yl-2-(oxolan-2-ylmethoxy)propanamide (PubChem CID 126832682) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-imidazo[1,2-a]pyrimidin-6-yl-2-(oxolan-2-ylmethoxy)propanamide.
| Compound Name | N-imidazo[1,2-a]pyrimidin-6-yl-2-(oxolan-2-ylmethoxy)propanamide |
|---|---|
| PubChem CID | 126832682 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N-imidazo[1,2-a]pyrimidin-6-yl-2-(oxolan-2-ylmethoxy)propanamide |
| SMILES | CC(OCC1CCCO1)C(=O)Nc1cnc2nccn2c1 |
| InChI | InChI=1S/C14H18N4O3/c1-10(21-9-12-3-2-6-20-12)13(19)17-11-7-16-14-15-4-5-18(14)8-11/h4-5,7-8,10,12H,2-3,6,9H2,1H3,(H,17,19) |
| InChIKey | XLHWDTMZEDXBGO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |