C19H23ClN4O — CID 95686874
1-(3-chloro-4-piperidin-1-ylphenyl)-3-[(1S)-1-pyridin-4-ylethyl]urea (PubChem CID 95686874) has the molecular formula C19H23ClN4O and a molecular weight of 358.87 g/mol. Its IUPAC name is 1-(3-chloro-4-piperidin-1-ylphenyl)-3-[(1S)-1-pyridin-4-ylethyl]urea.
| Compound Name | 1-(3-chloro-4-piperidin-1-ylphenyl)-3-[(1S)-1-pyridin-4-ylethyl]urea |
|---|---|
| PubChem CID | 95686874 |
| Molecular Formula | C19H23ClN4O |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 1-(3-chloro-4-piperidin-1-ylphenyl)-3-[(1S)-1-pyridin-4-ylethyl]urea |
| SMILES | C[C@H](NC(=O)Nc1ccc(N2CCCCC2)c(Cl)c1)c1ccncc1 |
| InChI | InChI=1S/C19H23ClN4O/c1-14(15-7-9-21-10-8-15)22-19(25)23-16-5-6-18(17(20)13-16)24-11-3-2-4-12-24/h5-10,13-14H,2-4,11-12H2,1H3,(H2,22,23,25)/t14-/m0/s1 |
| InChIKey | MRRLEFOZHBTCLZ-AWEZNQCLSA-N |
| XLogP | 4.61 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|