C15H18ClN5O — CID 75456168
1-(3-chloro-4-pyrrolidin-1-ylphenyl)-3-(1-methylpyrazol-3-yl)urea (PubChem CID 75456168) has the molecular formula C15H18ClN5O and a molecular weight of 319.80 g/mol. Its IUPAC name is 1-(3-chloro-4-pyrrolidin-1-ylphenyl)-3-(1-methylpyrazol-3-yl)urea.
| Compound Name | 1-(3-chloro-4-pyrrolidin-1-ylphenyl)-3-(1-methylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 75456168 |
| Molecular Formula | C15H18ClN5O |
| Molecular Weight | 319.80 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 1-(3-chloro-4-pyrrolidin-1-ylphenyl)-3-(1-methylpyrazol-3-yl)urea |
| SMILES | Cn1ccc(NC(=O)Nc2ccc(N3CCCC3)c(Cl)c2)n1 |
| InChI | InChI=1S/C15H18ClN5O/c1-20-9-6-14(19-20)18-15(22)17-11-4-5-13(12(16)10-11)21-7-2-3-8-21/h4-6,9-10H,2-3,7-8H2,1H3,(H2,17,18,19,22) |
| InChIKey | VMTPVPZUIOPUQB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.80 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|