C12H11Cl2N3OS — CID 3286045
1-(2,6-dichloro-4-pyridinyl)-3-(2-thiophen-2-ylethyl)urea (PubChem CID 3286045) has the molecular formula C12H11Cl2N3OS and a molecular weight of 316.21 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-pyridinyl)-3-(2-thiophen-2-ylethyl)urea.
| Compound Name | 1-(2,6-dichloro-4-pyridinyl)-3-(2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 3286045 |
| Molecular Formula | C12H11Cl2N3OS |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | 1-(2,6-dichloro-4-pyridinyl)-3-(2-thiophen-2-ylethyl)urea |
| SMILES | O=C(NCCc1cccs1)Nc1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C12H11Cl2N3OS/c13-10-6-8(7-11(14)17-10)16-12(18)15-4-3-9-2-1-5-19-9/h1-2,5-7H,3-4H2,(H2,15,16,17,18) |
| InChIKey | CBXCCPXVZOJKOY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|