C17H22ClN5OS — CID 60612019
1-(3-chloro-4-thiomorpholin-4-ylphenyl)-3-(3-imidazol-1-ylpropyl)urea (PubChem CID 60612019) has the molecular formula C17H22ClN5OS and a molecular weight of 379.92 g/mol. Its IUPAC name is 1-(3-chloro-4-thiomorpholin-4-ylphenyl)-3-(3-imidazol-1-ylpropyl)urea.
| Compound Name | 1-(3-chloro-4-thiomorpholin-4-ylphenyl)-3-(3-imidazol-1-ylpropyl)urea |
|---|---|
| PubChem CID | 60612019 |
| Molecular Formula | C17H22ClN5OS |
| Molecular Weight | 379.92 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 1-(3-chloro-4-thiomorpholin-4-ylphenyl)-3-(3-imidazol-1-ylpropyl)urea |
| SMILES | O=C(NCCCn1ccnc1)Nc1ccc(N2CCSCC2)c(Cl)c1 |
| InChI | InChI=1S/C17H22ClN5OS/c18-15-12-14(2-3-16(15)23-8-10-25-11-9-23)21-17(24)20-4-1-6-22-7-5-19-13-22/h2-3,5,7,12-13H,1,4,6,8-11H2,(H2,20,21,24) |
| InChIKey | JGOMEKZDVYRIOK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.92 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|