C18H20N2O4S — CID 119238490
(2S)-2-[[3-(4-thiophen-2-ylbutanoylamino)benzoyl]amino]propanoic acid (PubChem CID 119238490) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is (2S)-2-[[3-(4-thiophen-2-ylbutanoylamino)benzoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[3-(4-thiophen-2-ylbutanoylamino)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119238490 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (2S)-2-[[3-(4-thiophen-2-ylbutanoylamino)benzoyl]amino]propanoic acid |
| SMILES | C[C@H](NC(=O)c1cccc(NC(=O)CCCc2cccs2)c1)C(=O)O |
| InChI | InChI=1S/C18H20N2O4S/c1-12(18(23)24)19-17(22)13-5-2-6-14(11-13)20-16(21)9-3-7-15-8-4-10-25-15/h2,4-6,8,10-12H,3,7,9H2,1H3,(H,19,22)(H,20,21)(H,23,24)/t12-/m0/s1 |
| InChIKey | WFWJBJSBLUSPAT-LBPRGKRZSA-N |
| XLogP | 2.91 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |