C21H24N4O2S2 — CID 55965735
N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-(4-thiophen-2-ylbutanoylamino)benzamide (PubChem CID 55965735) has the molecular formula C21H24N4O2S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-(4-thiophen-2-ylbutanoylamino)benzamide.
| Compound Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-(4-thiophen-2-ylbutanoylamino)benzamide |
|---|---|
| PubChem CID | 55965735 |
| Molecular Formula | C21H24N4O2S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-(4-thiophen-2-ylbutanoylamino)benzamide |
| SMILES | CCCCc1nnc(NC(=O)c2cccc(NC(=O)CCCc3cccs3)c2)s1 |
| InChI | InChI=1S/C21H24N4O2S2/c1-2-3-12-19-24-25-21(29-19)23-20(27)15-7-4-8-16(14-15)22-18(26)11-5-9-17-10-6-13-28-17/h4,6-8,10,13-14H,2-3,5,9,11-12H2,1H3,(H,22,26)(H,23,25,27) |
| InChIKey | CKYOORTVZGOWSW-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |