C11H13N3OS2 — CID 18079690
N-(5-methyl-1,3,4-thiadiazol-2-yl)-4-thiophen-2-ylbutanamide (PubChem CID 18079690) has the molecular formula C11H13N3OS2 and a molecular weight of 267.38 g/mol. Its IUPAC name is N-(5-methyl-1,3,4-thiadiazol-2-yl)-4-thiophen-2-ylbutanamide.
| Compound Name | N-(5-methyl-1,3,4-thiadiazol-2-yl)-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 18079690 |
| Molecular Formula | C11H13N3OS2 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | N-(5-methyl-1,3,4-thiadiazol-2-yl)-4-thiophen-2-ylbutanamide |
| SMILES | Cc1nnc(NC(=O)CCCc2cccs2)s1 |
| InChI | InChI=1S/C11H13N3OS2/c1-8-13-14-11(17-8)12-10(15)6-2-4-9-5-3-7-16-9/h3,5,7H,2,4,6H2,1H3,(H,12,14,15) |
| InChIKey | NFNVGMGIFRPHBX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |