C13H17N3OS — CID 134698261
N-(1,3-dimethylpyrazol-4-yl)-4-thiophen-2-ylbutanamide (PubChem CID 134698261) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is N-(1,3-dimethylpyrazol-4-yl)-4-thiophen-2-ylbutanamide.
| Compound Name | N-(1,3-dimethylpyrazol-4-yl)-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 134698261 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N-(1,3-dimethylpyrazol-4-yl)-4-thiophen-2-ylbutanamide |
| SMILES | Cc1nn(C)cc1NC(=O)CCCc1cccs1 |
| InChI | InChI=1S/C13H17N3OS/c1-10-12(9-16(2)15-10)14-13(17)7-3-5-11-6-4-8-18-11/h4,6,8-9H,3,5,7H2,1-2H3,(H,14,17) |
| InChIKey | DIJNTXPVGAUGGN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |