C14H12F3NOS — CID 78781844
4-thiophen-2-yl-N-(2,3,4-trifluorophenyl)butanamide (PubChem CID 78781844) has the molecular formula C14H12F3NOS and a molecular weight of 299.32 g/mol. Its IUPAC name is 4-thiophen-2-yl-N-(2,3,4-trifluorophenyl)butanamide.
| Compound Name | 4-thiophen-2-yl-N-(2,3,4-trifluorophenyl)butanamide |
|---|---|
| PubChem CID | 78781844 |
| Molecular Formula | C14H12F3NOS |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 4-thiophen-2-yl-N-(2,3,4-trifluorophenyl)butanamide |
| SMILES | O=C(CCCc1cccs1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H12F3NOS/c15-10-6-7-11(14(17)13(10)16)18-12(19)5-1-3-9-4-2-8-20-9/h2,4,6-8H,1,3,5H2,(H,18,19) |
| InChIKey | YGPUYSCDIFAWNW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|