C14H10F3NO2S — CID 2379110
4-oxo-4-thiophen-2-yl-N-(2,3,4-trifluorophenyl)butanamide (PubChem CID 2379110) has the molecular formula C14H10F3NO2S and a molecular weight of 313.30 g/mol. Its IUPAC name is 4-oxo-4-thiophen-2-yl-N-(2,3,4-trifluorophenyl)butanamide.
| Compound Name | 4-oxo-4-thiophen-2-yl-N-(2,3,4-trifluorophenyl)butanamide |
|---|---|
| PubChem CID | 2379110 |
| Molecular Formula | C14H10F3NO2S |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 4-oxo-4-thiophen-2-yl-N-(2,3,4-trifluorophenyl)butanamide |
| SMILES | O=C(CCC(=O)c1cccs1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H10F3NO2S/c15-8-3-4-9(14(17)13(8)16)18-12(20)6-5-10(19)11-2-1-7-21-11/h1-4,7H,5-6H2,(H,18,20) |
| InChIKey | BNISIGCXVQFRJB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|